About 1-methylpiperidine-2,4-dione
1-methylpiperidine-2,4-dione (PubChem CID 19898279) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 1-methylpiperidine-2,4-dione.
Molecular Properties
| Compound Name | 1-methylpiperidine-2,4-dione |
| PubChem CID | 19898279 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 1-methylpiperidine-2,4-dione |
| SMILES | CN1CCC(=O)CC1=O |
| InChI | InChI=1S/C6H9NO2/c1-7-3-2-5(8)4-6(7)9/h2-4H2,1H3 |
| InChIKey | FLHLLNQXQGRGBP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidine-2,4-dione?
The IUPAC name of 1-methylpiperidine-2,4-dione (CID 19898279) is 1-methylpiperidine-2,4-dione.
What is the SMILES notation for 1-methylpiperidine-2,4-dione?
The canonical SMILES for 1-methylpiperidine-2,4-dione is CN1CCC(=O)CC1=O.
What is the InChIKey of 1-methylpiperidine-2,4-dione?
The InChIKey is FLHLLNQXQGRGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-7-3-2-5(8)4-6(7)9/h2-4H2,1H3.
What are the key properties of 1-methylpiperidine-2,4-dione?
1-methylpiperidine-2,4-dione has a molecular weight of 127.14 g/mol, XLogP of -0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidine-2,4-dione is sourced from PubChem (CID 19898279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).