About 1,3,5-trichlorocyclohexane
1,3,5-trichlorocyclohexane (PubChem CID 19898504) has the molecular formula C6H9Cl3
and a molecular weight of 187.50 g/mol. Its IUPAC name is 1,3,5-trichlorocyclohexane.
Molecular Properties
| Compound Name | 1,3,5-trichlorocyclohexane |
| PubChem CID | 19898504 |
| Molecular Formula | C6H9Cl3 |
| Molecular Weight | 187.50 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 1,3,5-trichlorocyclohexane |
| SMILES | ClC1CC(Cl)CC(Cl)C1 |
| InChI | InChI=1S/C6H9Cl3/c7-4-1-5(8)3-6(9)2-4/h4-6H,1-3H2 |
| InChIKey | VHIAVVFQACJCEC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-trichlorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trichlorocyclohexane?
The IUPAC name of 1,3,5-trichlorocyclohexane (CID 19898504) is 1,3,5-trichlorocyclohexane.
What is the SMILES notation for 1,3,5-trichlorocyclohexane?
The canonical SMILES for 1,3,5-trichlorocyclohexane is ClC1CC(Cl)CC(Cl)C1.
What is the InChIKey of 1,3,5-trichlorocyclohexane?
The InChIKey is VHIAVVFQACJCEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Cl3/c7-4-1-5(8)3-6(9)2-4/h4-6H,1-3H2.
What are the key properties of 1,3,5-trichlorocyclohexane?
1,3,5-trichlorocyclohexane has a molecular weight of 187.50 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trichlorocyclohexane is sourced from PubChem (CID 19898504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).