C27H35F3N2O2 — CID 19898627
(2E,4E)-3-methyl-N-(2-methylpropyl)-12-[4-(trifluoromethyl)quinolin-2-yl]oxydodeca-2,4-dienamide (PubChem CID 19898627) has the molecular formula C27H35F3N2O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is (2E,4E)-3-methyl-N-(2-methylpropyl)-12-[4-(trifluoromethyl)quinolin-2-yl]oxydodeca-2,4-dienamide.
| Compound Name | (2E,4E)-3-methyl-N-(2-methylpropyl)-12-[4-(trifluoromethyl)quinolin-2-yl]oxydodeca-2,4-dienamide |
|---|---|
| PubChem CID | 19898627 |
| Molecular Formula | C27H35F3N2O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (2E,4E)-3-methyl-N-(2-methylpropyl)-12-[4-(trifluoromethyl)quinolin-2-yl]oxydodeca-2,4-dienamide |
| SMILES | CC(/C=C/CCCCCCCOc1cc(C(F)(F)F)c2ccccc2n1)=C\C(=O)NCC(C)C |
| InChI | InChI=1S/C27H35F3N2O2/c1-20(2)19-31-25(33)17-21(3)13-9-7-5-4-6-8-12-16-34-26-18-23(27(28,29)30)22-14-10-11-15-24(22)32-26/h9-11,13-15,17-18,20H,4-8,12,16,19H2,1-3H3,(H,31,33)/b13-9+,21-17+ |
| InChIKey | AAJNBFUGXAOJON-OIKYDZLHSA-N |
| XLogP | 7.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|