About 2,6-dimethylpyrimidine-4,5-diamine
2,6-dimethylpyrimidine-4,5-diamine (PubChem CID 19898795) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,6-dimethylpyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 2,6-dimethylpyrimidine-4,5-diamine |
| PubChem CID | 19898795 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 2,6-dimethylpyrimidine-4,5-diamine |
| SMILES | Cc1nc(C)c(N)c(N)n1 |
| InChI | InChI=1S/C6H10N4/c1-3-5(7)6(8)10-4(2)9-3/h7H2,1-2H3,(H2,8,9,10) |
| InChIKey | LUUZXYGGFIJNCH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dimethylpyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylpyrimidine-4,5-diamine?
The IUPAC name of 2,6-dimethylpyrimidine-4,5-diamine (CID 19898795) is 2,6-dimethylpyrimidine-4,5-diamine.
What is the SMILES notation for 2,6-dimethylpyrimidine-4,5-diamine?
The canonical SMILES for 2,6-dimethylpyrimidine-4,5-diamine is Cc1nc(C)c(N)c(N)n1.
What is the InChIKey of 2,6-dimethylpyrimidine-4,5-diamine?
The InChIKey is LUUZXYGGFIJNCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-3-5(7)6(8)10-4(2)9-3/h7H2,1-2H3,(H2,8,9,10).
What are the key properties of 2,6-dimethylpyrimidine-4,5-diamine?
2,6-dimethylpyrimidine-4,5-diamine has a molecular weight of 138.17 g/mol, XLogP of 0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylpyrimidine-4,5-diamine is sourced from PubChem (CID 19898795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).