C32H38O9S — CID 19899140
3-[3-phenylmethoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropanal (PubChem CID 19899140) has the molecular formula C32H38O9S and a molecular weight of 598.71 g/mol. Its IUPAC name is 3-[3-phenylmethoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropanal.
| Compound Name | 3-[3-phenylmethoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropanal |
|---|---|
| PubChem CID | 19899140 |
| Molecular Formula | C32H38O9S |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 3-[3-phenylmethoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]sulfonylpropanal |
| SMILES | CCCOc1c(OCc2ccccc2)cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CCC=O |
| InChI | InChI=1S/C32H38O9S/c1-5-15-39-32-29(40-21-22-10-7-6-8-11-22)19-24(20-30(32)42(34,35)16-9-14-33)26-13-12-25(41-26)23-17-27(36-2)31(38-4)28(18-23)37-3/h6-8,10-11,14,17-20,25-26H,5,9,12-13,15-16,21H2,1-4H3 |
| InChIKey | KJBFRECCQDGHLI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|