About 6-azadispiro[2.0.34.33]decane-5,7-dione
6-azadispiro[2.0.34.33]decane-5,7-dione (PubChem CID 19899295) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 6-azadispiro[2.0.34.33]decane-5,7-dione.
Molecular Properties
| Compound Name | 6-azadispiro[2.0.34.33]decane-5,7-dione |
| PubChem CID | 19899295 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 6-azadispiro[2.0.34.33]decane-5,7-dione |
| SMILES | O=C1NC(=O)C12CCCC21CC1 |
| InChI | InChI=1S/C9H11NO2/c11-6-9(7(12)10-6)3-1-2-8(9)4-5-8/h1-5H2,(H,10,11,12) |
| InChIKey | NFMKIGGUHDPUKT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-azadispiro[2.0.34.33]decane-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azadispiro[2.0.34.33]decane-5,7-dione?
The IUPAC name of 6-azadispiro[2.0.34.33]decane-5,7-dione (CID 19899295) is 6-azadispiro[2.0.34.33]decane-5,7-dione.
What is the SMILES notation for 6-azadispiro[2.0.34.33]decane-5,7-dione?
The canonical SMILES for 6-azadispiro[2.0.34.33]decane-5,7-dione is O=C1NC(=O)C12CCCC21CC1.
What is the InChIKey of 6-azadispiro[2.0.34.33]decane-5,7-dione?
The InChIKey is NFMKIGGUHDPUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c11-6-9(7(12)10-6)3-1-2-8(9)4-5-8/h1-5H2,(H,10,11,12).
What are the key properties of 6-azadispiro[2.0.34.33]decane-5,7-dione?
6-azadispiro[2.0.34.33]decane-5,7-dione has a molecular weight of 165.19 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azadispiro[2.0.34.33]decane-5,7-dione is sourced from PubChem (CID 19899295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).