C10H7F11O2 — CID 19899314
ethyl 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-2-methylideneheptanoate (PubChem CID 19899314) has the molecular formula C10H7F11O2 and a molecular weight of 368.14 g/mol. Its IUPAC name is ethyl 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-2-methylideneheptanoate.
| Compound Name | ethyl 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-2-methylideneheptanoate |
|---|---|
| PubChem CID | 19899314 |
| Molecular Formula | C10H7F11O2 |
| Molecular Weight | 368.14 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | ethyl 3,3,4,4,5,5,6,6,7,7,7-undecafluoro-2-methylideneheptanoate |
| SMILES | C=C(C(=O)OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H7F11O2/c1-3-23-5(22)4(2)6(11,12)7(13,14)8(15,16)9(17,18)10(19,20)21/h2-3H2,1H3 |
| InChIKey | ODKHOALKRFSQHN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.14 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|