C19H28N2O3 — CID 19899503
3-[3-(dimethylamino)propyl]-3-(2-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione (PubChem CID 19899503) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propyl]-3-(2-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 3-[3-(dimethylamino)propyl]-3-(2-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 19899503 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 3-[3-(dimethylamino)propyl]-3-(2-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione |
| SMILES | COc1ccccc1C1(CCCN(C)C)C(=O)NC(=O)CC1(C)C |
| InChI | InChI=1S/C19H28N2O3/c1-18(2)13-16(22)20-17(23)19(18,11-8-12-21(3)4)14-9-6-7-10-15(14)24-5/h6-7,9-10H,8,11-13H2,1-5H3,(H,20,22,23) |
| InChIKey | ASSACWWNUGBQER-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|