C19H29N3O3 — CID 19899504
3-[1,1-bis(methylamino)propyl]-3-(3-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione (PubChem CID 19899504) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-[1,1-bis(methylamino)propyl]-3-(3-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 3-[1,1-bis(methylamino)propyl]-3-(3-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 19899504 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 3-[1,1-bis(methylamino)propyl]-3-(3-methoxyphenyl)-4,4-dimethylpiperidine-2,6-dione |
| SMILES | CCC(NC)(NC)C1(c2cccc(OC)c2)C(=O)NC(=O)CC1(C)C |
| InChI | InChI=1S/C19H29N3O3/c1-7-18(20-4,21-5)19(13-9-8-10-14(11-13)25-6)16(24)22-15(23)12-17(19,2)3/h8-11,20-21H,7,12H2,1-6H3,(H,22,23,24) |
| InChIKey | QDYDPBMLPULGSJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|