C18H18N2O4S — CID 19899609
[4-(hydroxyamino)-2-(2-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate (PubChem CID 19899609) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is [4-(hydroxyamino)-2-(2-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate.
| Compound Name | [4-(hydroxyamino)-2-(2-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
|---|---|
| PubChem CID | 19899609 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [4-(hydroxyamino)-2-(2-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
| SMILES | COc1ccccc1C1Sc2ccccc2N=C(NO)C1OC(C)=O |
| InChI | InChI=1S/C18H18N2O4S/c1-11(21)24-16-17(12-7-3-5-9-14(12)23-2)25-15-10-6-4-8-13(15)19-18(16)20-22/h3-10,16-17,22H,1-2H3,(H,19,20) |
| InChIKey | GQUPQVUKTGGPSE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|