C13H35N3Si3 — CID 19899908
trimethyl-[2-methyl-3,5-bis(trimethylsilyl)-1,3,5-triazinan-1-yl]silane (PubChem CID 19899908) has the molecular formula C13H35N3Si3 and a molecular weight of 317.70 g/mol. Its IUPAC name is trimethyl-[2-methyl-3,5-bis(trimethylsilyl)-1,3,5-triazinan-1-yl]silane.
| Compound Name | trimethyl-[2-methyl-3,5-bis(trimethylsilyl)-1,3,5-triazinan-1-yl]silane |
|---|---|
| PubChem CID | 19899908 |
| Molecular Formula | C13H35N3Si3 |
| Molecular Weight | 317.70 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | trimethyl-[2-methyl-3,5-bis(trimethylsilyl)-1,3,5-triazinan-1-yl]silane |
| SMILES | CC1N([Si](C)(C)C)CN([Si](C)(C)C)CN1[Si](C)(C)C |
| InChI | InChI=1S/C13H35N3Si3/c1-13-15(18(5,6)7)11-14(17(2,3)4)12-16(13)19(8,9)10/h13H,11-12H2,1-10H3 |
| InChIKey | PRDSKEKYLRHTIT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|