About 3,4-diethoxythiolane
3,4-diethoxythiolane (PubChem CID 19899986) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 3,4-diethoxythiolane.
Molecular Properties
| Compound Name | 3,4-diethoxythiolane |
| PubChem CID | 19899986 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3,4-diethoxythiolane |
| SMILES | CCOC1CSCC1OCC |
| InChI | InChI=1S/C8H16O2S/c1-3-9-7-5-11-6-8(7)10-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | QWJYMYCDIBVMBB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-diethoxythiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethoxythiolane?
The IUPAC name of 3,4-diethoxythiolane (CID 19899986) is 3,4-diethoxythiolane.
What is the SMILES notation for 3,4-diethoxythiolane?
The canonical SMILES for 3,4-diethoxythiolane is CCOC1CSCC1OCC.
What is the InChIKey of 3,4-diethoxythiolane?
The InChIKey is QWJYMYCDIBVMBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-3-9-7-5-11-6-8(7)10-4-2/h7-8H,3-6H2,1-2H3.
What are the key properties of 3,4-diethoxythiolane?
3,4-diethoxythiolane has a molecular weight of 176.28 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethoxythiolane is sourced from PubChem (CID 19899986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).