About ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane
ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane (PubChem CID 19900036) has the molecular formula C7H15F3O2Si
and a molecular weight of 216.27 g/mol. Its IUPAC name is ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 19900036 |
| Molecular Formula | C7H15F3O2Si |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane |
| SMILES | CC[Si](CCC(F)(F)F)(OC)OC |
| InChI | InChI=1S/C7H15F3O2Si/c1-4-13(11-2,12-3)6-5-7(8,9)10/h4-6H2,1-3H3 |
| InChIKey | HUPOESGDHWXZLA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
The IUPAC name of ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane (CID 19900036) is ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane is CC[Si](CCC(F)(F)F)(OC)OC.
What is the InChIKey of ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
The InChIKey is HUPOESGDHWXZLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F3O2Si/c1-4-13(11-2,12-3)6-5-7(8,9)10/h4-6H2,1-3H3.
What are the key properties of ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane has a molecular weight of 216.27 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-dimethoxy-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 19900036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).