About dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane
dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane (PubChem CID 19900037) has the molecular formula C7H15F3O2Si
and a molecular weight of 216.27 g/mol. Its IUPAC name is dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane.
Molecular Properties
| Compound Name | dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane |
| PubChem CID | 19900037 |
| Molecular Formula | C7H15F3O2Si |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane |
| SMILES | CO[Si](C)(OC)C(C)CC(F)(F)F |
| InChI | InChI=1S/C7H15F3O2Si/c1-6(5-7(8,9)10)13(4,11-2)12-3/h6H,5H2,1-4H3 |
| InChIKey | YJECYHIMDKTZCA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane?
The IUPAC name of dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane (CID 19900037) is dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane.
What is the SMILES notation for dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane?
The canonical SMILES for dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane is CO[Si](C)(OC)C(C)CC(F)(F)F.
What is the InChIKey of dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane?
The InChIKey is YJECYHIMDKTZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F3O2Si/c1-6(5-7(8,9)10)13(4,11-2)12-3/h6H,5H2,1-4H3.
What are the key properties of dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane?
dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane has a molecular weight of 216.27 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-methyl-(4,4,4-trifluorobutan-2-yl)silane is sourced from PubChem (CID 19900037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).