About dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane
dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane (PubChem CID 19900040) has the molecular formula C10H18F6O2Si
and a molecular weight of 312.33 g/mol. Its IUPAC name is dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane.
Molecular Properties
| Compound Name | dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane |
| PubChem CID | 19900040 |
| Molecular Formula | C10H18F6O2Si |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane |
| SMILES | CO[Si](OC)(C(C)CC(F)(F)F)C(C)CC(F)(F)F |
| InChI | InChI=1S/C10H18F6O2Si/c1-7(5-9(11,12)13)19(17-3,18-4)8(2)6-10(14,15)16/h7-8H,5-6H2,1-4H3 |
| InChIKey | YDPCJZOWLXZXKI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane?
The IUPAC name of dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane (CID 19900040) is dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane.
What is the SMILES notation for dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane?
The canonical SMILES for dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane is CO[Si](OC)(C(C)CC(F)(F)F)C(C)CC(F)(F)F.
What is the InChIKey of dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane?
The InChIKey is YDPCJZOWLXZXKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F6O2Si/c1-7(5-9(11,12)13)19(17-3,18-4)8(2)6-10(14,15)16/h7-8H,5-6H2,1-4H3.
What are the key properties of dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane?
dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane has a molecular weight of 312.33 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-bis(4,4,4-trifluorobutan-2-yl)silane is sourced from PubChem (CID 19900040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).