About tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane
tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane (PubChem CID 19900044) has the molecular formula C9H19F3O2Si
and a molecular weight of 244.33 g/mol. Its IUPAC name is tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 19900044 |
| Molecular Formula | C9H19F3O2Si |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane |
| SMILES | CO[Si](CCC(F)(F)F)(OC)C(C)(C)C |
| InChI | InChI=1S/C9H19F3O2Si/c1-8(2,3)15(13-4,14-5)7-6-9(10,11)12/h6-7H2,1-5H3 |
| InChIKey | CSBXJQZQXSFCHS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
The IUPAC name of tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane (CID 19900044) is tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane is CO[Si](CCC(F)(F)F)(OC)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
The InChIKey is CSBXJQZQXSFCHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3O2Si/c1-8(2,3)15(13-4,14-5)7-6-9(10,11)12/h6-7H2,1-5H3.
What are the key properties of tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane?
tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane has a molecular weight of 244.33 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethoxy-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 19900044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).