About azanium;scandium(3+);sulfate
azanium;scandium(3+);sulfate (PubChem CID 19900049) has the molecular formula H4NO4SSc+2
and a molecular weight of 159.06 g/mol. Its IUPAC name is azanium;scandium(3+);sulfate.
Molecular Properties
| Compound Name | azanium;scandium(3+);sulfate |
| PubChem CID | 19900049 |
| Molecular Formula | H4NO4SSc+2 |
| Molecular Weight | 159.06 g/mol |
| Exact Mass | 158.94 |
| IUPAC Name | azanium;scandium(3+);sulfate |
| SMILES | O=S(=O)([O-])[O-].[NH4+].[Sc+3] |
| InChI | InChI=1S/H3N.H2O4S.Sc/c;1-5(2,3)4;/h1H3;(H2,1,2,3,4);/q;;+3/p-1 |
| InChIKey | ASFUTODRBWNUCU-UHFFFAOYSA-M |
| XLogP | -0.96 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.06 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze azanium;scandium(3+);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;scandium(3+);sulfate?
The IUPAC name of azanium;scandium(3+);sulfate (CID 19900049) is azanium;scandium(3+);sulfate.
What is the SMILES notation for azanium;scandium(3+);sulfate?
The canonical SMILES for azanium;scandium(3+);sulfate is O=S(=O)([O-])[O-].[NH4+].[Sc+3].
What is the InChIKey of azanium;scandium(3+);sulfate?
The InChIKey is ASFUTODRBWNUCU-UHFFFAOYSA-M. The full InChI is InChI=1S/H3N.H2O4S.Sc/c;1-5(2,3)4;/h1H3;(H2,1,2,3,4);/q;;+3/p-1.
What are the key properties of azanium;scandium(3+);sulfate?
azanium;scandium(3+);sulfate has a molecular weight of 159.06 g/mol, XLogP of -0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;scandium(3+);sulfate is sourced from PubChem (CID 19900049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).