About 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid
2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid (PubChem CID 19900528) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid |
| PubChem CID | 19900528 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid |
| SMILES | C=CC1CC(CC(=O)O)OC(C)(C)O1 |
| InChI | InChI=1S/C10H16O4/c1-4-7-5-8(6-9(11)12)14-10(2,3)13-7/h4,7-8H,1,5-6H2,2-3H3,(H,11,12) |
| InChIKey | WFIZEPGTWUXFBZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid?
The IUPAC name of 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid (CID 19900528) is 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid.
What is the SMILES notation for 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid?
The canonical SMILES for 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid is C=CC1CC(CC(=O)O)OC(C)(C)O1.
What is the InChIKey of 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid?
The InChIKey is WFIZEPGTWUXFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-4-7-5-8(6-9(11)12)14-10(2,3)13-7/h4,7-8H,1,5-6H2,2-3H3,(H,11,12).
What are the key properties of 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid?
2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid has a molecular weight of 200.23 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl)acetic acid is sourced from PubChem (CID 19900528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).