C40H35N5O10 — CID 19900601
[2-(pyridine-3-carbonyloxy)-1,3,3-tris(pyridine-3-carbonyloxymethyl)cyclohexyl]methyl pyridine-3-carboxylate (PubChem CID 19900601) has the molecular formula C40H35N5O10 and a molecular weight of 745.75 g/mol. Its IUPAC name is [2-(pyridine-3-carbonyloxy)-1,3,3-tris(pyridine-3-carbonyloxymethyl)cyclohexyl]methyl pyridine-3-carboxylate.
| Compound Name | [2-(pyridine-3-carbonyloxy)-1,3,3-tris(pyridine-3-carbonyloxymethyl)cyclohexyl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 19900601 |
| Molecular Formula | C40H35N5O10 |
| Molecular Weight | 745.75 g/mol |
| Exact Mass | 745.24 |
| IUPAC Name | [2-(pyridine-3-carbonyloxy)-1,3,3-tris(pyridine-3-carbonyloxymethyl)cyclohexyl]methyl pyridine-3-carboxylate |
| SMILES | O=C(OCC1(COC(=O)c2cccnc2)CCCC(COC(=O)c2cccnc2)(COC(=O)c2cccnc2)C1OC(=O)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C40H35N5O10/c46-33(28-7-1-14-41-19-28)51-24-39(25-52-34(47)29-8-2-15-42-20-29)12-6-13-40(26-53-35(48)30-9-3-16-43-21-30,27-54-36(49)31-10-4-17-44-22-31)38(39)55-37(50)32-11-5-18-45-23-32/h1-5,7-11,14-23,38H,6,12-13,24-27H2 |
| InChIKey | RFEDEVQXYDEEPL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 195.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|