C30H32N2O4 — CID 19900727
1-benzyl-2-(5,5-diethoxy-1,3-dioxan-2-yl)-4,5-diphenylimidazole (PubChem CID 19900727) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-benzyl-2-(5,5-diethoxy-1,3-dioxan-2-yl)-4,5-diphenylimidazole.
| Compound Name | 1-benzyl-2-(5,5-diethoxy-1,3-dioxan-2-yl)-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 19900727 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 1-benzyl-2-(5,5-diethoxy-1,3-dioxan-2-yl)-4,5-diphenylimidazole |
| SMILES | CCOC1(OCC)COC(c2nc(-c3ccccc3)c(-c3ccccc3)n2Cc2ccccc2)OC1 |
| InChI | InChI=1S/C30H32N2O4/c1-3-35-30(36-4-2)21-33-29(34-22-30)28-31-26(24-16-10-6-11-17-24)27(25-18-12-7-13-19-25)32(28)20-23-14-8-5-9-15-23/h5-19,29H,3-4,20-22H2,1-2H3 |
| InChIKey | JEALLROVUSLJJS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|