C48H93N9O3 — CID 19900898
2-[4-[4-[[4,6-bis[4-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]butyl]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol (PubChem CID 19900898) has the molecular formula C48H93N9O3 and a molecular weight of 844.33 g/mol. Its IUPAC name is 2-[4-[4-[[4,6-bis[4-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]butyl]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol.
| Compound Name | 2-[4-[4-[[4,6-bis[4-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]butyl]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 19900898 |
| Molecular Formula | C48H93N9O3 |
| Molecular Weight | 844.33 g/mol |
| Exact Mass | 843.74 |
| IUPAC Name | 2-[4-[4-[[4,6-bis[4-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]butylamino]-1,3,5-triazin-2-yl]amino]butyl]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
| SMILES | CC1(C)CC(CCCCNc2nc(NCCCCC3CC(C)(C)N(CCO)C(C)(C)C3)nc(NCCCCC3CC(C)(C)N(CCO)C(C)(C)C3)n2)CC(C)(C)N1CCO |
| InChI | InChI=1S/C48H93N9O3/c1-43(2)31-37(32-44(3,4)55(43)25-28-58)19-13-16-22-49-40-52-41(50-23-17-14-20-38-33-45(5,6)56(26-29-59)46(7,8)34-38)54-42(53-40)51-24-18-15-21-39-35-47(9,10)57(27-30-60)48(11,12)36-39/h37-39,58-60H,13-36H2,1-12H3,(H3,49,50,51,52,53,54) |
| InChIKey | JJMXESRLMHIFLE-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.33 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|