About 4-morpholin-2-ylaniline
4-morpholin-2-ylaniline (PubChem CID 19900974) has the molecular formula C10H14N2O
and a molecular weight of 178.24 g/mol. Its IUPAC name is 4-morpholin-2-ylaniline.
Molecular Properties
| Compound Name | 4-morpholin-2-ylaniline |
| PubChem CID | 19900974 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-morpholin-2-ylaniline |
| SMILES | Nc1ccc(C2CNCCO2)cc1 |
| InChI | InChI=1S/C10H14N2O/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10/h1-4,10,12H,5-7,11H2 |
| InChIKey | GXWFKPDLDBPQEW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-morpholin-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-2-ylaniline?
The IUPAC name of 4-morpholin-2-ylaniline (CID 19900974) is 4-morpholin-2-ylaniline.
What is the SMILES notation for 4-morpholin-2-ylaniline?
The canonical SMILES for 4-morpholin-2-ylaniline is Nc1ccc(C2CNCCO2)cc1.
What is the InChIKey of 4-morpholin-2-ylaniline?
The InChIKey is GXWFKPDLDBPQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10/h1-4,10,12H,5-7,11H2.
What are the key properties of 4-morpholin-2-ylaniline?
4-morpholin-2-ylaniline has a molecular weight of 178.24 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-2-ylaniline is sourced from PubChem (CID 19900974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).