C32H64O5S — CID 19901099
1-[2-[2-(oxan-2-yloxy)ethoxy]ethylsulfanyl]-3-(3,7,11,15-tetramethylhexadecoxy)propan-2-ol (PubChem CID 19901099) has the molecular formula C32H64O5S and a molecular weight of 560.93 g/mol. Its IUPAC name is 1-[2-[2-(oxan-2-yloxy)ethoxy]ethylsulfanyl]-3-(3,7,11,15-tetramethylhexadecoxy)propan-2-ol.
| Compound Name | 1-[2-[2-(oxan-2-yloxy)ethoxy]ethylsulfanyl]-3-(3,7,11,15-tetramethylhexadecoxy)propan-2-ol |
|---|---|
| PubChem CID | 19901099 |
| Molecular Formula | C32H64O5S |
| Molecular Weight | 560.93 g/mol |
| Exact Mass | 560.45 |
| IUPAC Name | 1-[2-[2-(oxan-2-yloxy)ethoxy]ethylsulfanyl]-3-(3,7,11,15-tetramethylhexadecoxy)propan-2-ol |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CCOCC(O)CSCCOCCOC1CCCCO1 |
| InChI | InChI=1S/C32H64O5S/c1-27(2)11-8-12-28(3)13-9-14-29(4)15-10-16-30(5)18-20-35-25-31(33)26-38-24-23-34-21-22-37-32-17-6-7-19-36-32/h27-33H,6-26H2,1-5H3 |
| InChIKey | FGEPFJKFESVWAH-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.93 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|