C52H46N4O4 — CID 19901228
5,10,15,20-tetrakis[(4-methoxyphenyl)methyl]-21,22-dihydroporphyrin (PubChem CID 19901228) has the molecular formula C52H46N4O4 and a molecular weight of 790.96 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[(4-methoxyphenyl)methyl]-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[(4-methoxyphenyl)methyl]-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 19901228 |
| Molecular Formula | C52H46N4O4 |
| Molecular Weight | 790.96 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | 5,10,15,20-tetrakis[(4-methoxyphenyl)methyl]-21,22-dihydroporphyrin |
| SMILES | COc1ccc(Cc2c3nc(c(Cc4ccc(OC)cc4)c4ccc([nH]4)c(Cc4ccc(OC)cc4)c4ccc([nH]4)c(Cc4ccc(OC)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H46N4O4/c1-57-37-13-5-33(6-14-37)29-41-45-21-23-47(53-45)42(30-34-7-15-38(58-2)16-8-34)49-25-27-51(55-49)44(32-36-11-19-40(60-4)20-12-36)52-28-26-50(56-52)43(48-24-22-46(41)54-48)31-35-9-17-39(59-3)18-10-35/h5-28,53-54H,29-32H2,1-4H3/b45-41-,46-41-,47-42-,48-43-,49-42-,50-43-,51-44-,52-44- |
| InChIKey | PXRIHGVHYFHAOA-PLBBUBFRSA-N |
| XLogP | 11.05 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.96 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |