C13H9N5 — CID 19902182
2,4,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,10,12,14-hexaene-5-carbonitrile (PubChem CID 19902182) has the molecular formula C13H9N5 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2,4,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,10,12,14-hexaene-5-carbonitrile.
| Compound Name | 2,4,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,10,12,14-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 19902182 |
| Molecular Formula | C13H9N5 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2,4,7,10-tetrazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,10,12,14-hexaene-5-carbonitrile |
| SMILES | N#Cc1ncn2c1N1CCN=C1c1ccccc1-2 |
| InChI | InChI=1S/C13H9N5/c14-7-10-13-17-6-5-15-12(17)9-3-1-2-4-11(9)18(13)8-16-10/h1-4,8H,5-6H2 |
| InChIKey | RRHSNOLLAPAGFD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |