About 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine
3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine (PubChem CID 19902665) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine.
Analyze 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine?
The IUPAC name of 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine (CID 19902665) is 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine.
What is the SMILES notation for 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine?
The canonical SMILES for 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine is C1CN=C2CCNCN2C1.
What is the InChIKey of 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine?
The InChIKey is AVGSKBUYCGIAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-3-9-7-2-4-8-6-10(7)5-1/h8H,1-6H2.
What are the key properties of 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine?
3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine has a molecular weight of 139.20 g/mol, XLogP of 0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-c]pyrimidine is sourced from PubChem (CID 19902665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).