About 5-amino-4a,5-dihydro-1H-naphthalen-2-one
5-amino-4a,5-dihydro-1H-naphthalen-2-one (PubChem CID 19902704) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 5-amino-4a,5-dihydro-1H-naphthalen-2-one.
Molecular Properties
| Compound Name | 5-amino-4a,5-dihydro-1H-naphthalen-2-one |
| PubChem CID | 19902704 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5-amino-4a,5-dihydro-1H-naphthalen-2-one |
| SMILES | NC1C=CC=C2CC(=O)C=CC21 |
| InChI | InChI=1S/C10H11NO/c11-10-3-1-2-7-6-8(12)4-5-9(7)10/h1-5,9-10H,6,11H2 |
| InChIKey | PRNCXDRRAPWHPM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-amino-4a,5-dihydro-1H-naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4a,5-dihydro-1H-naphthalen-2-one?
The IUPAC name of 5-amino-4a,5-dihydro-1H-naphthalen-2-one (CID 19902704) is 5-amino-4a,5-dihydro-1H-naphthalen-2-one.
What is the SMILES notation for 5-amino-4a,5-dihydro-1H-naphthalen-2-one?
The canonical SMILES for 5-amino-4a,5-dihydro-1H-naphthalen-2-one is NC1C=CC=C2CC(=O)C=CC21.
What is the InChIKey of 5-amino-4a,5-dihydro-1H-naphthalen-2-one?
The InChIKey is PRNCXDRRAPWHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c11-10-3-1-2-7-6-8(12)4-5-9(7)10/h1-5,9-10H,6,11H2.
What are the key properties of 5-amino-4a,5-dihydro-1H-naphthalen-2-one?
5-amino-4a,5-dihydro-1H-naphthalen-2-one has a molecular weight of 161.20 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4a,5-dihydro-1H-naphthalen-2-one is sourced from PubChem (CID 19902704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).