C9H10N2O2 — CID 19902709
ethyl 3-amino-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene-7-carboxylate (PubChem CID 19902709) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is ethyl 3-amino-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene-7-carboxylate.
| Compound Name | ethyl 3-amino-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene-7-carboxylate |
|---|---|
| PubChem CID | 19902709 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | ethyl 3-amino-7-azabicyclo[4.1.0]hepta-1(6),2,4-triene-7-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(N)cc21 |
| InChI | InChI=1S/C9H10N2O2/c1-2-13-9(12)11-7-4-3-6(10)5-8(7)11/h3-5H,2,10H2,1H3 |
| InChIKey | IZIBOSJZTFYNGX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|