C17H16N7S2+ — CID 19903675
1-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazolidin-1-ium-3,5-dithione (PubChem CID 19903675) has the molecular formula C17H16N7S2+ and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazolidin-1-ium-3,5-dithione.
| Compound Name | 1-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazolidin-1-ium-3,5-dithione |
|---|---|
| PubChem CID | 19903675 |
| Molecular Formula | C17H16N7S2+ |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-methyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazolidin-1-ium-3,5-dithione |
| SMILES | C[N+]1(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)NC(=S)NC1=S |
| InChI | InChI=1S/C17H15N7S2/c1-24(17(26)18-16(25)21-24)10-11-6-8-12(9-7-11)13-4-2-3-5-14(13)15-19-22-23-20-15/h2-9H,10H2,1H3,(H2-,18,19,20,21,22,23,25,26)/p+1 |
| InChIKey | FTDKCZGRHLTAIG-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|