C12H23N3 — CID 19904182
3,5-dipentyl-1H-1,2,4-triazole (PubChem CID 19904182) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 3,5-dipentyl-1H-1,2,4-triazole.
| Compound Name | 3,5-dipentyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 19904182 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 3,5-dipentyl-1H-1,2,4-triazole |
| SMILES | CCCCCc1n[nH]c(CCCCC)n1 |
| InChI | InChI=1S/C12H23N3/c1-3-5-7-9-11-13-12(15-14-11)10-8-6-4-2/h3-10H2,1-2H3,(H,13,14,15) |
| InChIKey | UAQGAGMEOFACHT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|