About spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one
spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one (PubChem CID 19904308) has the molecular formula C17H14O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one.
Molecular Properties
| Compound Name | spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one |
| PubChem CID | 19904308 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one |
| SMILES | O=C1OC2(CCCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C17H14O2/c18-16-13-8-2-4-10-15(13)17(19-16)11-5-7-12-6-1-3-9-14(12)17/h1-4,6,8-10H,5,7,11H2 |
| InChIKey | FKOWKNZTCXLZRJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one?
The IUPAC name of spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one (CID 19904308) is spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one.
What is the SMILES notation for spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one?
The canonical SMILES for spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one is O=C1OC2(CCCc3ccccc32)c2ccccc21.
What is the InChIKey of spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one?
The InChIKey is FKOWKNZTCXLZRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O2/c18-16-13-8-2-4-10-15(13)17(19-16)11-5-7-12-6-1-3-9-14(12)17/h1-4,6,8-10H,5,7,11H2.
What are the key properties of spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one?
spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one has a molecular weight of 250.30 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2,3-dihydro-1H-naphthalene-4,3'-2-benzofuran]-1'-one is sourced from PubChem (CID 19904308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).