C19H32N2O4Si — CID 19904721
5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 19904721) has the molecular formula C19H32N2O4Si and a molecular weight of 380.56 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19904721 |
| Molecular Formula | C19H32N2O4Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(C2CCC(O[Si](C)(C)C(C)(C)C)CC2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C19H32N2O4Si/c1-7-12-19(15(22)20-17(24)21-16(19)23)13-8-10-14(11-9-13)25-26(5,6)18(2,3)4/h7,13-14H,1,8-12H2,2-6H3,(H2,20,21,22,23,24) |
| InChIKey | IEDPKJMUUUIOFJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|