C12H14ClNOS — CID 19905279
1-(4-chlorophenyl)-3-(1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 19905279) has the molecular formula C12H14ClNOS and a molecular weight of 255.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(1,3-thiazolidin-3-yl)propan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-(1,3-thiazolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 19905279 |
| Molecular Formula | C12H14ClNOS |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | O=C(CCN1CCSC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNOS/c13-11-3-1-10(2-4-11)12(15)5-6-14-7-8-16-9-14/h1-4H,5-9H2 |
| InChIKey | JPSPTSMFMYHRQY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |