About 2-(dibromomethyl)oxetane
2-(dibromomethyl)oxetane (PubChem CID 19905814) has the molecular formula C4H6Br2O
and a molecular weight of 229.90 g/mol. Its IUPAC name is 2-(dibromomethyl)oxetane.
Molecular Properties
| Compound Name | 2-(dibromomethyl)oxetane |
| PubChem CID | 19905814 |
| Molecular Formula | C4H6Br2O |
| Molecular Weight | 229.90 g/mol |
| Exact Mass | 227.88 |
| IUPAC Name | 2-(dibromomethyl)oxetane |
| SMILES | BrC(Br)C1CCO1 |
| InChI | InChI=1S/C4H6Br2O/c5-4(6)3-1-2-7-3/h3-4H,1-2H2 |
| InChIKey | ZLPGBYKIQWHJSZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.90 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibromomethyl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibromomethyl)oxetane?
The IUPAC name of 2-(dibromomethyl)oxetane (CID 19905814) is 2-(dibromomethyl)oxetane.
What is the SMILES notation for 2-(dibromomethyl)oxetane?
The canonical SMILES for 2-(dibromomethyl)oxetane is BrC(Br)C1CCO1.
What is the InChIKey of 2-(dibromomethyl)oxetane?
The InChIKey is ZLPGBYKIQWHJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Br2O/c5-4(6)3-1-2-7-3/h3-4H,1-2H2.
What are the key properties of 2-(dibromomethyl)oxetane?
2-(dibromomethyl)oxetane has a molecular weight of 229.90 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibromomethyl)oxetane is sourced from PubChem (CID 19905814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).