About N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide
N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide (PubChem CID 19906194) has the molecular formula C26H30NOP
and a molecular weight of 403.51 g/mol. Its IUPAC name is N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide.
Molecular Properties
| Compound Name | N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide |
| PubChem CID | 19906194 |
| Molecular Formula | C26H30NOP |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide |
| SMILES | CCCN(CCC)C(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30NOP/c1-3-20-27(21-4-2)26(28)22-29(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22H,3-4,20-21H2,1-2H3 |
| InChIKey | SACCSGGSWZIDIS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The IUPAC name of N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide (CID 19906194) is N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide.
What is the SMILES notation for N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The canonical SMILES for N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide is CCCN(CCC)C(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
The InChIKey is SACCSGGSWZIDIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30NOP/c1-3-20-27(21-4-2)26(28)22-29(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,22H,3-4,20-21H2,1-2H3.
What are the key properties of N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide?
N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide has a molecular weight of 403.51 g/mol, XLogP of 4.43, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropyl-2-(triphenyl-λ5-phosphanylidene)acetamide is sourced from PubChem (CID 19906194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).