C24H28ClNO2 — CID 19906296
ethyl 2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]acetate;hydrochloride (PubChem CID 19906296) has the molecular formula C24H28ClNO2 and a molecular weight of 397.95 g/mol. Its IUPAC name is ethyl 2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]acetate;hydrochloride.
| Compound Name | ethyl 2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 19906296 |
| Molecular Formula | C24H28ClNO2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | ethyl 2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)CN1CCC(=C2c3ccccc3CCc3ccccc32)CC1.Cl |
| InChI | InChI=1S/C24H27NO2.ClH/c1-2-27-23(26)17-25-15-13-20(14-16-25)24-21-9-5-3-7-18(21)11-12-19-8-4-6-10-22(19)24;/h3-10H,2,11-17H2,1H3;1H |
| InChIKey | AFDNKSUUKCRWLY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|