About 1-fluoroethane-1,2-diol
1-fluoroethane-1,2-diol (PubChem CID 19906354) has the molecular formula C2H5FO2
and a molecular weight of 80.06 g/mol. Its IUPAC name is 1-fluoroethane-1,2-diol.
Molecular Properties
| Compound Name | 1-fluoroethane-1,2-diol |
| PubChem CID | 19906354 |
| Molecular Formula | C2H5FO2 |
| Molecular Weight | 80.06 g/mol |
| Exact Mass | 80.03 |
| IUPAC Name | 1-fluoroethane-1,2-diol |
| SMILES | OCC(O)F |
| InChI | InChI=1S/C2H5FO2/c3-2(5)1-4/h2,4-5H,1H2 |
| InChIKey | QNVQPXNRAJFKQV-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 80.06 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoroethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethane-1,2-diol?
The IUPAC name of 1-fluoroethane-1,2-diol (CID 19906354) is 1-fluoroethane-1,2-diol.
What is the SMILES notation for 1-fluoroethane-1,2-diol?
The canonical SMILES for 1-fluoroethane-1,2-diol is OCC(O)F.
What is the InChIKey of 1-fluoroethane-1,2-diol?
The InChIKey is QNVQPXNRAJFKQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5FO2/c3-2(5)1-4/h2,4-5H,1H2.
What are the key properties of 1-fluoroethane-1,2-diol?
1-fluoroethane-1,2-diol has a molecular weight of 80.06 g/mol, XLogP of -0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethane-1,2-diol is sourced from PubChem (CID 19906354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).