C11H17NO4S — CID 19906422
N,N-bis(2-hydroxyethyl)-1-phenylmethanesulfonamide (PubChem CID 19906422) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-1-phenylmethanesulfonamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 19906422 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)N(CCO)CCO |
| InChI | InChI=1S/C11H17NO4S/c13-8-6-12(7-9-14)17(15,16)10-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2 |
| InChIKey | SXKYANNECXFDFM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |