About [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol
[2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol (PubChem CID 19906528) has the molecular formula C11H20OS2
and a molecular weight of 232.41 g/mol. Its IUPAC name is [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol |
| PubChem CID | 19906528 |
| Molecular Formula | C11H20OS2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol |
| SMILES | OCC1CCCCC1CC1SCCS1 |
| InChI | InChI=1S/C11H20OS2/c12-8-10-4-2-1-3-9(10)7-11-13-5-6-14-11/h9-12H,1-8H2 |
| InChIKey | WIUMSIXNJUQPOD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol?
The IUPAC name of [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol (CID 19906528) is [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol.
What is the SMILES notation for [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol?
The canonical SMILES for [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol is OCC1CCCCC1CC1SCCS1.
What is the InChIKey of [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol?
The InChIKey is WIUMSIXNJUQPOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS2/c12-8-10-4-2-1-3-9(10)7-11-13-5-6-14-11/h9-12H,1-8H2.
What are the key properties of [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol?
[2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol has a molecular weight of 232.41 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dithiolan-2-ylmethyl)cyclohexyl]methanol is sourced from PubChem (CID 19906528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).