About 3,8-dichlorothianthrene-2,7-disulfonyl chloride
3,8-dichlorothianthrene-2,7-disulfonyl chloride (PubChem CID 19906684) has the molecular formula C12H4Cl4O4S4
and a molecular weight of 482.24 g/mol. Its IUPAC name is 3,8-dichlorothianthrene-2,7-disulfonyl chloride.
Molecular Properties
| Compound Name | 3,8-dichlorothianthrene-2,7-disulfonyl chloride |
| PubChem CID | 19906684 |
| Molecular Formula | C12H4Cl4O4S4 |
| Molecular Weight | 482.24 g/mol |
| Exact Mass | 479.77 |
| IUPAC Name | 3,8-dichlorothianthrene-2,7-disulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc2c(cc1Cl)Sc1cc(S(=O)(=O)Cl)c(Cl)cc1S2 |
| InChI | InChI=1S/C12H4Cl4O4S4/c13-5-1-7-9(3-11(5)23(15,17)18)22-8-2-6(14)12(24(16,19)20)4-10(8)21-7/h1-4H |
| InChIKey | HXIWFJMZKONJNO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.24 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,8-dichlorothianthrene-2,7-disulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dichlorothianthrene-2,7-disulfonyl chloride?
The IUPAC name of 3,8-dichlorothianthrene-2,7-disulfonyl chloride (CID 19906684) is 3,8-dichlorothianthrene-2,7-disulfonyl chloride.
What is the SMILES notation for 3,8-dichlorothianthrene-2,7-disulfonyl chloride?
The canonical SMILES for 3,8-dichlorothianthrene-2,7-disulfonyl chloride is O=S(=O)(Cl)c1cc2c(cc1Cl)Sc1cc(S(=O)(=O)Cl)c(Cl)cc1S2.
What is the InChIKey of 3,8-dichlorothianthrene-2,7-disulfonyl chloride?
The InChIKey is HXIWFJMZKONJNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Cl4O4S4/c13-5-1-7-9(3-11(5)23(15,17)18)22-8-2-6(14)12(24(16,19)20)4-10(8)21-7/h1-4H.
What are the key properties of 3,8-dichlorothianthrene-2,7-disulfonyl chloride?
3,8-dichlorothianthrene-2,7-disulfonyl chloride has a molecular weight of 482.24 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dichlorothianthrene-2,7-disulfonyl chloride is sourced from PubChem (CID 19906684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).