About benzo[b]thianthrene
benzo[b]thianthrene (PubChem CID 19906774) has the molecular formula C16H10S2
and a molecular weight of 266.39 g/mol. Its IUPAC name is benzo[b]thianthrene.
Molecular Properties
| Compound Name | benzo[b]thianthrene |
| PubChem CID | 19906774 |
| Molecular Formula | C16H10S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | benzo[b]thianthrene |
| SMILES | c1ccc2c(c1)Sc1cc3ccccc3cc1S2 |
| InChI | InChI=1S/C16H10S2/c1-2-6-12-10-16-15(9-11(12)5-1)17-13-7-3-4-8-14(13)18-16/h1-10H |
| InChIKey | TZCHHMRINAZUPZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[b]thianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b]thianthrene?
The IUPAC name of benzo[b]thianthrene (CID 19906774) is benzo[b]thianthrene.
What is the SMILES notation for benzo[b]thianthrene?
The canonical SMILES for benzo[b]thianthrene is c1ccc2c(c1)Sc1cc3ccccc3cc1S2.
What is the InChIKey of benzo[b]thianthrene?
The InChIKey is TZCHHMRINAZUPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10S2/c1-2-6-12-10-16-15(9-11(12)5-1)17-13-7-3-4-8-14(13)18-16/h1-10H.
What are the key properties of benzo[b]thianthrene?
benzo[b]thianthrene has a molecular weight of 266.39 g/mol, XLogP of 5.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b]thianthrene is sourced from PubChem (CID 19906774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).