3,7-dichlorothianthrene-2,8-disulfonyl chloride

C12H4Cl4O4S4 — CID 19906776

IUPAC3,7-dichlorothianthrene-2,8-disulfonyl chloride
SMILESO=S(=O)(Cl)c1cc2c(cc1Cl)Sc1cc(Cl)c(S(=O)(=O)Cl)cc1S2
InChIInChI=1S/C12H4Cl4O4S4/c13-5-1-7-9(3-11(5)23(15,17)18)22-10-4-12(24(16,19)20)6(14)2-8(10)21-7/h1-4H
InChIKeyPLIXQIIOUXHUEZ-UHFFFAOYSA-N
MW482.24 g/mol
LogP5.46
Rot. Bonds2

About 3,7-dichlorothianthrene-2,8-disulfonyl chloride

3,7-dichlorothianthrene-2,8-disulfonyl chloride (PubChem CID 19906776) has the molecular formula C12H4Cl4O4S4 and a molecular weight of 482.24 g/mol. Its IUPAC name is 3,7-dichlorothianthrene-2,8-disulfonyl chloride.

Molecular Properties

Compound Name3,7-dichlorothianthrene-2,8-disulfonyl chloride
PubChem CID19906776
Molecular FormulaC12H4Cl4O4S4
Molecular Weight482.24 g/mol
Exact Mass479.77
IUPAC Name3,7-dichlorothianthrene-2,8-disulfonyl chloride
SMILESO=S(=O)(Cl)c1cc2c(cc1Cl)Sc1cc(Cl)c(S(=O)(=O)Cl)cc1S2
InChIInChI=1S/C12H4Cl4O4S4/c13-5-1-7-9(3-11(5)23(15,17)18)22-10-4-12(24(16,19)20)6(14)2-8(10)21-7/h1-4H
InChIKeyPLIXQIIOUXHUEZ-UHFFFAOYSA-N
XLogP5.46
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500482.24
LogP ≤ 55.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 3,7-dichlorothianthrene-2,8-disulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,7-dichlorothianthrene-2,8-disulfonyl chloride?
The IUPAC name of 3,7-dichlorothianthrene-2,8-disulfonyl chloride (CID 19906776) is 3,7-dichlorothianthrene-2,8-disulfonyl chloride.
What is the SMILES notation for 3,7-dichlorothianthrene-2,8-disulfonyl chloride?
The canonical SMILES for 3,7-dichlorothianthrene-2,8-disulfonyl chloride is O=S(=O)(Cl)c1cc2c(cc1Cl)Sc1cc(Cl)c(S(=O)(=O)Cl)cc1S2.
What is the InChIKey of 3,7-dichlorothianthrene-2,8-disulfonyl chloride?
The InChIKey is PLIXQIIOUXHUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Cl4O4S4/c13-5-1-7-9(3-11(5)23(15,17)18)22-10-4-12(24(16,19)20)6(14)2-8(10)21-7/h1-4H.
What are the key properties of 3,7-dichlorothianthrene-2,8-disulfonyl chloride?
3,7-dichlorothianthrene-2,8-disulfonyl chloride has a molecular weight of 482.24 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dichlorothianthrene-2,8-disulfonyl chloride is sourced from PubChem (CID 19906776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).