C19H28O7 — CID 19907097
diethyl 5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate (PubChem CID 19907097) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is diethyl 5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate.
| Compound Name | diethyl 5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate |
|---|---|
| PubChem CID | 19907097 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | diethyl 5',5'-dimethyl-2-oxospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1C(=O)C(C(=O)OCC)C2CC3(CC12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C19H28O7/c1-5-23-16(21)13-11-7-19(25-9-18(3,4)10-26-19)8-12(11)14(15(13)20)17(22)24-6-2/h11-14H,5-10H2,1-4H3 |
| InChIKey | MCNKZEJMBCZYEH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|