About 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide
4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 19907192) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide |
| PubChem CID | 19907192 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CC(O)CN1 |
| InChI | InChI=1S/C7H14N2O2/c1-9(2)7(11)6-3-5(10)4-8-6/h5-6,8,10H,3-4H2,1-2H3 |
| InChIKey | ZOHZTBXVKULCNB-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide?
The IUPAC name of 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide (CID 19907192) is 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide.
What is the SMILES notation for 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide?
The canonical SMILES for 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide is CN(C)C(=O)C1CC(O)CN1.
What is the InChIKey of 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide?
The InChIKey is ZOHZTBXVKULCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-9(2)7(11)6-3-5(10)4-8-6/h5-6,8,10H,3-4H2,1-2H3.
What are the key properties of 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide?
4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide has a molecular weight of 158.20 g/mol, XLogP of -1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N,N-dimethylpyrrolidine-2-carboxamide is sourced from PubChem (CID 19907192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).