About 4-(3,4-diaminophenyl)phenol
4-(3,4-diaminophenyl)phenol (PubChem CID 19907643) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(3,4-diaminophenyl)phenol.
Molecular Properties
| Compound Name | 4-(3,4-diaminophenyl)phenol |
| PubChem CID | 19907643 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 4-(3,4-diaminophenyl)phenol |
| SMILES | Nc1ccc(-c2ccc(O)cc2)cc1N |
| InChI | InChI=1S/C12H12N2O/c13-11-6-3-9(7-12(11)14)8-1-4-10(15)5-2-8/h1-7,15H,13-14H2 |
| InChIKey | VOWBBUTVSZXTPR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-diaminophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-diaminophenyl)phenol?
The IUPAC name of 4-(3,4-diaminophenyl)phenol (CID 19907643) is 4-(3,4-diaminophenyl)phenol.
What is the SMILES notation for 4-(3,4-diaminophenyl)phenol?
The canonical SMILES for 4-(3,4-diaminophenyl)phenol is Nc1ccc(-c2ccc(O)cc2)cc1N.
What is the InChIKey of 4-(3,4-diaminophenyl)phenol?
The InChIKey is VOWBBUTVSZXTPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c13-11-6-3-9(7-12(11)14)8-1-4-10(15)5-2-8/h1-7,15H,13-14H2.
What are the key properties of 4-(3,4-diaminophenyl)phenol?
4-(3,4-diaminophenyl)phenol has a molecular weight of 200.24 g/mol, XLogP of 2.22, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-diaminophenyl)phenol is sourced from PubChem (CID 19907643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).