C8H14N2 — CID 19908240
5-ethyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 19908240) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 5-ethyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-ethyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 19908240 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 5-ethyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCN1CC2=C(CNC2)C1 |
| InChI | InChI=1S/C8H14N2/c1-2-10-5-7-3-9-4-8(7)6-10/h9H,2-6H2,1H3 |
| InChIKey | DIUIWIVCLOVEMH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|