About N-methyl-N-prop-2-enylacetamide;prop-2-enamide
N-methyl-N-prop-2-enylacetamide;prop-2-enamide (PubChem CID 19908629) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is N-methyl-N-prop-2-enylacetamide;prop-2-enamide.
Molecular Properties
| Compound Name | N-methyl-N-prop-2-enylacetamide;prop-2-enamide |
| PubChem CID | 19908629 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-methyl-N-prop-2-enylacetamide;prop-2-enamide |
| SMILES | C=CC(N)=O.C=CCN(C)C(C)=O |
| InChI | InChI=1S/C6H11NO.C3H5NO/c1-4-5-7(3)6(2)8;1-2-3(4)5/h4H,1,5H2,2-3H3;2H,1H2,(H2,4,5) |
| InChIKey | CPXICTAJGMRFAW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-prop-2-enylacetamide;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-prop-2-enylacetamide;prop-2-enamide?
The IUPAC name of N-methyl-N-prop-2-enylacetamide;prop-2-enamide (CID 19908629) is N-methyl-N-prop-2-enylacetamide;prop-2-enamide.
What is the SMILES notation for N-methyl-N-prop-2-enylacetamide;prop-2-enamide?
The canonical SMILES for N-methyl-N-prop-2-enylacetamide;prop-2-enamide is C=CC(N)=O.C=CCN(C)C(C)=O.
What is the InChIKey of N-methyl-N-prop-2-enylacetamide;prop-2-enamide?
The InChIKey is CPXICTAJGMRFAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C3H5NO/c1-4-5-7(3)6(2)8;1-2-3(4)5/h4H,1,5H2,2-3H3;2H,1H2,(H2,4,5).
What are the key properties of N-methyl-N-prop-2-enylacetamide;prop-2-enamide?
N-methyl-N-prop-2-enylacetamide;prop-2-enamide has a molecular weight of 184.24 g/mol, XLogP of 0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-prop-2-enylacetamide;prop-2-enamide is sourced from PubChem (CID 19908629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).