About 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene
1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene (PubChem CID 19908653) has the molecular formula C22H28
and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene |
| PubChem CID | 19908653 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene |
| SMILES | C=Cc1cc(C)ccc1C.C=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H16.C10H12/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-4-10-7-8(2)5-6-9(10)3/h5-9H,1H2,2-4H3;4-7H,1H2,2-3H3 |
| InChIKey | ATEILXDEEWOQRE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene?
The IUPAC name of 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene (CID 19908653) is 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene.
What is the SMILES notation for 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene?
The canonical SMILES for 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene is C=Cc1cc(C)ccc1C.C=Cc1ccc(C(C)(C)C)cc1.
What is the InChIKey of 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene?
The InChIKey is ATEILXDEEWOQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C10H12/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-4-10-7-8(2)5-6-9(10)3/h5-9H,1H2,2-4H3;4-7H,1H2,2-3H3.
What are the key properties of 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene?
1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene has a molecular weight of 292.47 g/mol, XLogP of 6.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-ethenylbenzene;2-ethenyl-1,4-dimethylbenzene is sourced from PubChem (CID 19908653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).