About 5-methylidenehepta-1,3-diyne
5-methylidenehepta-1,3-diyne (PubChem CID 19908664) has the molecular formula C8H8
and a molecular weight of 104.15 g/mol. Its IUPAC name is 5-methylidenehepta-1,3-diyne.
Molecular Properties
| Compound Name | 5-methylidenehepta-1,3-diyne |
| PubChem CID | 19908664 |
| Molecular Formula | C8H8 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | 5-methylidenehepta-1,3-diyne |
| SMILES | C#CC#CC(=C)CC |
| InChI | InChI=1S/C8H8/c1-4-6-7-8(3)5-2/h1H,3,5H2,2H3 |
| InChIKey | MGGAYGKLWITSLO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methylidenehepta-1,3-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidenehepta-1,3-diyne?
The IUPAC name of 5-methylidenehepta-1,3-diyne (CID 19908664) is 5-methylidenehepta-1,3-diyne.
What is the SMILES notation for 5-methylidenehepta-1,3-diyne?
The canonical SMILES for 5-methylidenehepta-1,3-diyne is C#CC#CC(=C)CC.
What is the InChIKey of 5-methylidenehepta-1,3-diyne?
The InChIKey is MGGAYGKLWITSLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8/c1-4-6-7-8(3)5-2/h1H,3,5H2,2H3.
What are the key properties of 5-methylidenehepta-1,3-diyne?
5-methylidenehepta-1,3-diyne has a molecular weight of 104.15 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidenehepta-1,3-diyne is sourced from PubChem (CID 19908664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).