About 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride
2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride (PubChem CID 19908697) has the molecular formula C12H15ClN2O5S
and a molecular weight of 334.78 g/mol. Its IUPAC name is 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride |
| PubChem CID | 19908697 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride |
| SMILES | Cl.Nc1cc(S(=O)(=O)c2ccc(O)c(N)c2)ccc1O.O |
| InChI | InChI=1S/C12H12N2O4S.ClH.H2O/c13-9-5-7(1-3-11(9)15)19(17,18)8-2-4-12(16)10(14)6-8;;/h1-6,15-16H,13-14H2;1H;1H2 |
| InChIKey | KIIIIIUUHHGDMM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 158.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride?
The IUPAC name of 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride (CID 19908697) is 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride.
What is the SMILES notation for 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride?
The canonical SMILES for 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride is Cl.Nc1cc(S(=O)(=O)c2ccc(O)c(N)c2)ccc1O.O.
What is the InChIKey of 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride?
The InChIKey is KIIIIIUUHHGDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S.ClH.H2O/c13-9-5-7(1-3-11(9)15)19(17,18)8-2-4-12(16)10(14)6-8;;/h1-6,15-16H,13-14H2;1H;1H2.
What are the key properties of 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride?
2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride has a molecular weight of 334.78 g/mol, XLogP of 0.69, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(3-amino-4-hydroxyphenyl)sulfonylphenol;hydrate;hydrochloride is sourced from PubChem (CID 19908697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).